C21H33N3O — CID 134121693
N-(3-hydroxyphenyl)-3,5-dimethyl-N'-(2-methylcyclohexyl)piperidine-1-carboximidamide (PubChem CID 134121693) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-3,5-dimethyl-N'-(2-methylcyclohexyl)piperidine-1-carboximidamide.
| Compound Name | N-(3-hydroxyphenyl)-3,5-dimethyl-N'-(2-methylcyclohexyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134121693 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | N-(3-hydroxyphenyl)-3,5-dimethyl-N'-(2-methylcyclohexyl)piperidine-1-carboximidamide |
| SMILES | CC1CC(C)CN(/C(=N\C2CCCCC2C)Nc2cccc(O)c2)C1 |
| InChI | InChI=1S/C21H33N3O/c1-15-11-16(2)14-24(13-15)21(22-18-8-6-9-19(25)12-18)23-20-10-5-4-7-17(20)3/h6,8-9,12,15-17,20,25H,4-5,7,10-11,13-14H2,1-3H3,(H,22,23) |
| InChIKey | GJECFRQKVHOWIW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|