C11H6Cl3N3O4 — CID 134100427
2,4,6-trichloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)benzamide (PubChem CID 134100427) has the molecular formula C11H6Cl3N3O4 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)benzamide.
| Compound Name | 2,4,6-trichloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 134100427 |
| Molecular Formula | C11H6Cl3N3O4 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 2,4,6-trichloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1noc(NC(=O)c2c(Cl)cc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H6Cl3N3O4/c1-4-9(17(19)20)11(21-16-4)15-10(18)8-6(13)2-5(12)3-7(8)14/h2-3H,1H3,(H,15,18) |
| InChIKey | MCIIZOXDOAGTSU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|