About methyl 3-chlorobenzenecarboximidothioate;hydroiodide
methyl 3-chlorobenzenecarboximidothioate;hydroiodide (PubChem CID 134101984) has the molecular formula C8H9ClINS
and a molecular weight of 313.59 g/mol. Its IUPAC name is methyl 3-chlorobenzenecarboximidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl 3-chlorobenzenecarboximidothioate;hydroiodide |
| PubChem CID | 134101984 |
| Molecular Formula | C8H9ClINS |
| Molecular Weight | 313.59 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | methyl 3-chlorobenzenecarboximidothioate;hydroiodide |
| SMILES | I.[H]/N=C(\SC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H8ClNS.HI/c1-11-8(10)6-3-2-4-7(9)5-6;/h2-5,10H,1H3;1H/b10-8-; |
| InChIKey | QBZVOTUPKCXEJH-DQMXGCRQSA-N |
| XLogP | 3.65 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chlorobenzenecarboximidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chlorobenzenecarboximidothioate;hydroiodide?
The IUPAC name of methyl 3-chlorobenzenecarboximidothioate;hydroiodide (CID 134101984) is methyl 3-chlorobenzenecarboximidothioate;hydroiodide.
What is the SMILES notation for methyl 3-chlorobenzenecarboximidothioate;hydroiodide?
The canonical SMILES for methyl 3-chlorobenzenecarboximidothioate;hydroiodide is I.[H]/N=C(\SC)c1cccc(Cl)c1.
What is the InChIKey of methyl 3-chlorobenzenecarboximidothioate;hydroiodide?
The InChIKey is QBZVOTUPKCXEJH-DQMXGCRQSA-N. The full InChI is InChI=1S/C8H8ClNS.HI/c1-11-8(10)6-3-2-4-7(9)5-6;/h2-5,10H,1H3;1H/b10-8-;.
What are the key properties of methyl 3-chlorobenzenecarboximidothioate;hydroiodide?
methyl 3-chlorobenzenecarboximidothioate;hydroiodide has a molecular weight of 313.59 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chlorobenzenecarboximidothioate;hydroiodide is sourced from PubChem (CID 134101984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).