C10H12Cl2N2OS — CID 174677651
1,3-dichlorobenzene;methyl N-acetylcarbamimidothioate (PubChem CID 174677651) has the molecular formula C10H12Cl2N2OS and a molecular weight of 279.19 g/mol. Its IUPAC name is 1,3-dichlorobenzene;methyl N-acetylcarbamimidothioate.
| Compound Name | 1,3-dichlorobenzene;methyl N-acetylcarbamimidothioate |
|---|---|
| PubChem CID | 174677651 |
| Molecular Formula | C10H12Cl2N2OS |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1,3-dichlorobenzene;methyl N-acetylcarbamimidothioate |
| SMILES | Clc1cccc(Cl)c1.[H]/N=C(/NC(C)=O)SC |
| InChI | InChI=1S/C6H4Cl2.C4H8N2OS/c7-5-2-1-3-6(8)4-5;1-3(7)6-4(5)8-2/h1-4H;1-2H3,(H2,5,6,7) |
| InChIKey | ZKBTWCAIXZVHRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|