C12H11ClO3S2 — CID 170873580
2-(3-chlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enoic acid (PubChem CID 170873580) has the molecular formula C12H11ClO3S2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-(3-chlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enoic acid.
| Compound Name | 2-(3-chlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 170873580 |
| Molecular Formula | C12H11ClO3S2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2-(3-chlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enoic acid |
| SMILES | CSC(SC)=C(C(=O)O)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClO3S2/c1-17-12(18-2)9(11(15)16)10(14)7-4-3-5-8(13)6-7/h3-6H,1-2H3,(H,15,16) |
| InChIKey | RUMUCYPXRHDVTD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|