About 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one
12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one (PubChem CID 134102350) has the molecular formula C26H20O4
and a molecular weight of 396.44 g/mol. Its IUPAC name is 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one.
Molecular Properties
| Compound Name | 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one |
| PubChem CID | 134102350 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one |
| SMILES | COc1cc2c3ccc(C)cc3c(=O)oc2c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C26H20O4/c1-16-11-12-18-20-14-23(28-2)24-19(25(20)30-26(27)21(18)13-16)9-6-10-22(24)29-15-17-7-4-3-5-8-17/h3-14H,15H2,1-2H3 |
| InChIKey | WPOCRIMTGMIZRU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one?
The IUPAC name of 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one (CID 134102350) is 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one.
What is the SMILES notation for 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one?
The canonical SMILES for 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one is COc1cc2c3ccc(C)cc3c(=O)oc2c2cccc(OCc3ccccc3)c12.
What is the InChIKey of 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one?
The InChIKey is WPOCRIMTGMIZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20O4/c1-16-11-12-18-20-14-23(28-2)24-19(25(20)30-26(27)21(18)13-16)9-6-10-22(24)29-15-17-7-4-3-5-8-17/h3-14H,15H2,1-2H3.
What are the key properties of 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one?
12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one has a molecular weight of 396.44 g/mol, XLogP of 6.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methoxy-8-methyl-1-phenylmethoxynaphtho[1,2-c]isochromen-6-one is sourced from PubChem (CID 134102350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).