C15H23ClN6O4S — CID 134104247
N-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]methanesulfonamide (PubChem CID 134104247) has the molecular formula C15H23ClN6O4S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 134104247 |
| Molecular Formula | C15H23ClN6O4S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]methanesulfonamide |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCCCOc1cc(NS(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H23ClN6O4S/c1-15(2)20-13(17)19-14(18)22(15)26-8-4-7-25-12-9-10(5-6-11(12)16)21-27(3,23)24/h5-6,9,21H,4,7-8H2,1-3H3,(H4,17,18,19,20) |
| InChIKey | RCDWBABRYHAVPY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|