C17H26ClN7O3 — CID 134104245
1-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]-3-ethylurea (PubChem CID 134104245) has the molecular formula C17H26ClN7O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]-3-ethylurea.
| Compound Name | 1-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 134104245 |
| Molecular Formula | C17H26ClN7O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[4-chloro-3-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propoxy]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(Cl)c(OCCCON2C(N)=NC(N)=NC2(C)C)c1 |
| InChI | InChI=1S/C17H26ClN7O3/c1-4-21-16(26)22-11-6-7-12(18)13(10-11)27-8-5-9-28-25-15(20)23-14(19)24-17(25,2)3/h6-7,10H,4-5,8-9H2,1-3H3,(H2,21,22,26)(H4,19,20,23,24) |
| InChIKey | AWQOAQDKSVUXJU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|