About sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate
sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate (PubChem CID 134104316) has the molecular formula C9H14NNaO3
and a molecular weight of 207.20 g/mol. Its IUPAC name is sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate |
| PubChem CID | 134104316 |
| Molecular Formula | C9H14NNaO3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate |
| SMILES | CCCCNC(=O)/C=C(\C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H15NO3.Na/c1-3-4-5-10-8(11)6-7(2)9(12)13;/h6H,3-5H2,1-2H3,(H,10,11)(H,12,13);/q;+1/p-1/b7-6+; |
| InChIKey | LLDIHJMXRIHZAM-UHDJGPCESA-M |
| XLogP | -3.40 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate?
The IUPAC name of sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate (CID 134104316) is sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate.
What is the SMILES notation for sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate?
The canonical SMILES for sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate is CCCCNC(=O)/C=C(\C)C(=O)[O-].[Na+].
What is the InChIKey of sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate?
The InChIKey is LLDIHJMXRIHZAM-UHDJGPCESA-M. The full InChI is InChI=1S/C9H15NO3.Na/c1-3-4-5-10-8(11)6-7(2)9(12)13;/h6H,3-5H2,1-2H3,(H,10,11)(H,12,13);/q;+1/p-1/b7-6+;.
What are the key properties of sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate?
sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate has a molecular weight of 207.20 g/mol, XLogP of -3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (E)-4-(butylamino)-2-methyl-4-oxobut-2-enoate is sourced from PubChem (CID 134104316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).