About sodium N-dodecylcarbamate
sodium N-dodecylcarbamate (PubChem CID 141389395) has the molecular formula C13H26NNaO2
and a molecular weight of 251.35 g/mol. Its IUPAC name is sodium N-dodecylcarbamate.
Molecular Properties
| Compound Name | sodium N-dodecylcarbamate |
| PubChem CID | 141389395 |
| Molecular Formula | C13H26NNaO2 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | sodium N-dodecylcarbamate |
| SMILES | CCCCCCCCCCCCNC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H27NO2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-14-13(15)16;/h14H,2-12H2,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | HCYWSHCYEUEVRZ-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium N-dodecylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-dodecylcarbamate?
The IUPAC name of sodium N-dodecylcarbamate (CID 141389395) is sodium N-dodecylcarbamate.
What is the SMILES notation for sodium N-dodecylcarbamate?
The canonical SMILES for sodium N-dodecylcarbamate is CCCCCCCCCCCCNC(=O)[O-].[Na+].
What is the InChIKey of sodium N-dodecylcarbamate?
The InChIKey is HCYWSHCYEUEVRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H27NO2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-14-13(15)16;/h14H,2-12H2,1H3,(H,15,16);/q;+1/p-1.
What are the key properties of sodium N-dodecylcarbamate?
sodium N-dodecylcarbamate has a molecular weight of 251.35 g/mol, XLogP of -0.16, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-dodecylcarbamate is sourced from PubChem (CID 141389395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).