C18H17Cl3N2O — CID 134104323
N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide (PubChem CID 134104323) has the molecular formula C18H17Cl3N2O and a molecular weight of 383.71 g/mol. Its IUPAC name is N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide.
| Compound Name | N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 134104323 |
| Molecular Formula | C18H17Cl3N2O |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)N(/N=C/c1ccc(Cl)cc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3N2O/c1-18(2,3)23(22-11-12-4-6-14(19)7-5-12)17(24)13-8-15(20)10-16(21)9-13/h4-11H,1-3H3/b22-11+ |
| InChIKey | MMLMTLZSEWNOCW-SSDVNMTOSA-N |
| XLogP | 5.92 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|