About N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide
N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide (PubChem CID 134104323) has the molecular formula C18H17Cl3N2O
and a molecular weight of 383.71 g/mol. Its IUPAC name is N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide.
Molecular Properties
| Compound Name | N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide |
| PubChem CID | 134104323 |
| Molecular Formula | C18H17Cl3N2O |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)N(/N=C/c1ccc(Cl)cc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3N2O/c1-18(2,3)23(22-11-12-4-6-14(19)7-5-12)17(24)13-8-15(20)10-16(21)9-13/h4-11H,1-3H3/b22-11+ |
| InChIKey | MMLMTLZSEWNOCW-SSDVNMTOSA-N |
| XLogP | 5.92 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide?
The IUPAC name of N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide (CID 134104323) is N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide.
What is the SMILES notation for N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide?
The canonical SMILES for N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide is CC(C)(C)N(/N=C/c1ccc(Cl)cc1)C(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide?
The InChIKey is MMLMTLZSEWNOCW-SSDVNMTOSA-N. The full InChI is InChI=1S/C18H17Cl3N2O/c1-18(2,3)23(22-11-12-4-6-14(19)7-5-12)17(24)13-8-15(20)10-16(21)9-13/h4-11H,1-3H3/b22-11+.
What are the key properties of N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide?
N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide has a molecular weight of 383.71 g/mol, XLogP of 5.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,5-dichloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide is sourced from PubChem (CID 134104323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).