About 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline
2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline (PubChem CID 134104597) has the molecular formula C10H6BrN3O4S2
and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline.
Molecular Properties
| Compound Name | 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline |
| PubChem CID | 134104597 |
| Molecular Formula | C10H6BrN3O4S2 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 374.90 |
| IUPAC Name | 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline |
| SMILES | Nc1ccccc1Sc1sc(Br)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6BrN3O4S2/c11-9-7(13(15)16)8(14(17)18)10(20-9)19-6-4-2-1-3-5(6)12/h1-4H,12H2 |
| InChIKey | ZSIUWKJIDUNOQV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline?
The IUPAC name of 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline (CID 134104597) is 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline.
What is the SMILES notation for 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline?
The canonical SMILES for 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline is Nc1ccccc1Sc1sc(Br)c([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline?
The InChIKey is ZSIUWKJIDUNOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrN3O4S2/c11-9-7(13(15)16)8(14(17)18)10(20-9)19-6-4-2-1-3-5(6)12/h1-4H,12H2.
What are the key properties of 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline?
2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline has a molecular weight of 376.21 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-3,4-dinitrothiophen-2-yl)sulfanylaniline is sourced from PubChem (CID 134104597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).