C24H15Cl2F2N3O4 — CID 134106021
7-chloro-4a-(4-chlorophenyl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-2-carboxamide (PubChem CID 134106021) has the molecular formula C24H15Cl2F2N3O4 and a molecular weight of 518.30 g/mol. Its IUPAC name is 7-chloro-4a-(4-chlorophenyl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-2-carboxamide.
| Compound Name | 7-chloro-4a-(4-chlorophenyl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-2-carboxamide |
|---|---|
| PubChem CID | 134106021 |
| Molecular Formula | C24H15Cl2F2N3O4 |
| Molecular Weight | 518.30 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 7-chloro-4a-(4-chlorophenyl)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)N1COC2(c3ccc(Cl)cc3)Cc3cc(Cl)ccc3C2=N1 |
| InChI | InChI=1S/C24H15Cl2F2N3O4/c25-15-3-1-14(2-4-15)23-11-13-9-16(26)5-7-18(13)21(23)30-31(12-33-23)22(32)29-17-6-8-19-20(10-17)35-24(27,28)34-19/h1-10H,11-12H2,(H,29,32) |
| InChIKey | FAGRTAGIVDEUES-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.30 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |