C19H19N3O — CID 134106632
3-(4-phenoxyphenyl)-2,3-diazabicyclo[2.2.2]octane-2-carbonitrile (PubChem CID 134106632) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-2,3-diazabicyclo[2.2.2]octane-2-carbonitrile.
| Compound Name | 3-(4-phenoxyphenyl)-2,3-diazabicyclo[2.2.2]octane-2-carbonitrile |
|---|---|
| PubChem CID | 134106632 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(4-phenoxyphenyl)-2,3-diazabicyclo[2.2.2]octane-2-carbonitrile |
| SMILES | N#CN1C2CCC(CC2)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O/c20-14-21-15-6-8-16(9-7-15)22(21)17-10-12-19(13-11-17)23-18-4-2-1-3-5-18/h1-5,10-13,15-16H,6-9H2 |
| InChIKey | UZDLFMUYYIOUGZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|