C25H35N5O — CID 134108610
N'-[(1S,2S)-2-aminocyclohexyl]-4-methyl-N-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide (PubChem CID 134108610) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N'-[(1S,2S)-2-aminocyclohexyl]-4-methyl-N-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(1S,2S)-2-aminocyclohexyl]-4-methyl-N-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134108610 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N'-[(1S,2S)-2-aminocyclohexyl]-4-methyl-N-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CN1CCN(/C(=N\[C@H]2CCCC[C@@H]2N)Nc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H35N5O/c1-29-15-17-30(18-16-29)25(28-24-10-6-5-9-23(24)26)27-21-11-13-22(14-12-21)31-19-20-7-3-2-4-8-20/h2-4,7-8,11-14,23-24H,5-6,9-10,15-19,26H2,1H3,(H,27,28)/t23-,24-/m0/s1 |
| InChIKey | HWMGNBDHTAZCAY-ZEQRLZLVSA-N |
| XLogP | 3.55 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|