C15H24ClFN4 — CID 134108655
2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-propan-2-ylguanidine (PubChem CID 134108655) has the molecular formula C15H24ClFN4 and a molecular weight of 314.84 g/mol. Its IUPAC name is 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-propan-2-ylguanidine.
| Compound Name | 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 134108655 |
| Molecular Formula | C15H24ClFN4 |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-propan-2-ylguanidine |
| SMILES | CC(C)N/C(=N\CC(C)(C)CN)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClFN4/c1-10(2)20-14(19-9-15(3,4)8-18)21-11-5-6-13(17)12(16)7-11/h5-7,10H,8-9,18H2,1-4H3,(H2,19,20,21) |
| InChIKey | SARKPSZAGRJIEL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|