C14H22ClFN4O — CID 134108664
2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)guanidine (PubChem CID 134108664) has the molecular formula C14H22ClFN4O and a molecular weight of 316.81 g/mol. Its IUPAC name is 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)guanidine.
| Compound Name | 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)guanidine |
|---|---|
| PubChem CID | 134108664 |
| Molecular Formula | C14H22ClFN4O |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-(3-amino-2,2-dimethylpropyl)-1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)guanidine |
| SMILES | CC(C)(CN)C/N=C(\NCCO)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClFN4O/c1-14(2,8-17)9-19-13(18-5-6-21)20-10-3-4-12(16)11(15)7-10/h3-4,7,21H,5-6,8-9,17H2,1-2H3,(H2,18,19,20) |
| InChIKey | XWNLGKKTYPDXBN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|