C20H30NO9P — CID 134108945
2-[bis(2-hydroxyethyl)amino]ethanol;bis(2-methoxyphenyl) hydrogen phosphate (PubChem CID 134108945) has the molecular formula C20H30NO9P and a molecular weight of 459.43 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;bis(2-methoxyphenyl) hydrogen phosphate.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;bis(2-methoxyphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 134108945 |
| Molecular Formula | C20H30NO9P |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;bis(2-methoxyphenyl) hydrogen phosphate |
| SMILES | COc1ccccc1OP(=O)(O)Oc1ccccc1OC.OCCN(CCO)CCO |
| InChI | InChI=1S/C14H15O6P.C6H15NO3/c1-17-11-7-3-5-9-13(11)19-21(15,16)20-14-10-6-4-8-12(14)18-2;8-4-1-7(2-5-9)3-6-10/h3-10H,1-2H3,(H,15,16);8-10H,1-6H2 |
| InChIKey | USJKCGAJTXETCC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|