About bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride
bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride (PubChem CID 88640951) has the molecular formula C15H21ClNO6P
and a molecular weight of 377.76 g/mol. Its IUPAC name is bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride |
| PubChem CID | 88640951 |
| Molecular Formula | C15H21ClNO6P |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride |
| SMILES | COc1ccccc1OP(=O)(CN)Oc1ccccc1OC.Cl.O |
| InChI | InChI=1S/C15H18NO5P.ClH.H2O/c1-18-12-7-3-5-9-14(12)20-22(17,11-16)21-15-10-6-4-8-13(15)19-2;;/h3-10H,11,16H2,1-2H3;1H;1H2 |
| InChIKey | GCNNBMGLKPNZRX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride?
The IUPAC name of bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride (CID 88640951) is bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride.
What is the SMILES notation for bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride?
The canonical SMILES for bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride is COc1ccccc1OP(=O)(CN)Oc1ccccc1OC.Cl.O.
What is the InChIKey of bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride?
The InChIKey is GCNNBMGLKPNZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18NO5P.ClH.H2O/c1-18-12-7-3-5-9-14(12)20-22(17,11-16)21-15-10-6-4-8-13(15)19-2;;/h3-10H,11,16H2,1-2H3;1H;1H2.
What are the key properties of bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride?
bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride has a molecular weight of 377.76 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyphenoxy)phosphorylmethanamine;hydrate;hydrochloride is sourced from PubChem (CID 88640951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).