C17H17F3NO6P — CID 86742078
N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide (PubChem CID 86742078) has the molecular formula C17H17F3NO6P and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86742078 |
| Molecular Formula | C17H17F3NO6P |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccccc1OP(=O)(CNC(=O)C(F)(F)F)Oc1ccccc1OC |
| InChI | InChI=1S/C17H17F3NO6P/c1-24-12-7-3-5-9-14(12)26-28(23,11-21-16(22)17(18,19)20)27-15-10-6-4-8-13(15)25-2/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | VQSMHJOMDDXTLH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|