About N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide
N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide (PubChem CID 86742078) has the molecular formula C17H17F3NO6P
and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 86742078 |
| Molecular Formula | C17H17F3NO6P |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccccc1OP(=O)(CNC(=O)C(F)(F)F)Oc1ccccc1OC |
| InChI | InChI=1S/C17H17F3NO6P/c1-24-12-7-3-5-9-14(12)26-28(23,11-21-16(22)17(18,19)20)27-15-10-6-4-8-13(15)25-2/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | VQSMHJOMDDXTLH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide (CID 86742078) is N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide is COc1ccccc1OP(=O)(CNC(=O)C(F)(F)F)Oc1ccccc1OC.
What is the InChIKey of N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide?
The InChIKey is VQSMHJOMDDXTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3NO6P/c1-24-12-7-3-5-9-14(12)26-28(23,11-21-16(22)17(18,19)20)27-15-10-6-4-8-13(15)25-2/h3-10H,11H2,1-2H3,(H,21,22).
What are the key properties of N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide?
N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide has a molecular weight of 419.29 g/mol, XLogP of 3.99, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(2-methoxyphenoxy)phosphorylmethyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 86742078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).