C9H8Cl2F3N3O — CID 134109501
1-amino-3-(2,5-dichlorophenyl)-1-(2,2,2-trifluoroethyl)urea (PubChem CID 134109501) has the molecular formula C9H8Cl2F3N3O and a molecular weight of 302.08 g/mol. Its IUPAC name is 1-amino-3-(2,5-dichlorophenyl)-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-amino-3-(2,5-dichlorophenyl)-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 134109501 |
| Molecular Formula | C9H8Cl2F3N3O |
| Molecular Weight | 302.08 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1-amino-3-(2,5-dichlorophenyl)-1-(2,2,2-trifluoroethyl)urea |
| SMILES | NN(CC(F)(F)F)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2F3N3O/c10-5-1-2-6(11)7(3-5)16-8(18)17(15)4-9(12,13)14/h1-3H,4,15H2,(H,16,18) |
| InChIKey | NJNWVQHUVOGEPE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|