C16H12Cl2N2O3S — CID 134112136
4-[[2-[(3,4-dichlorophenyl)methylamino]-2-sulfanylideneacetyl]amino]benzoic acid (PubChem CID 134112136) has the molecular formula C16H12Cl2N2O3S and a molecular weight of 383.26 g/mol. Its IUPAC name is 4-[[2-[(3,4-dichlorophenyl)methylamino]-2-sulfanylideneacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(3,4-dichlorophenyl)methylamino]-2-sulfanylideneacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 134112136 |
| Molecular Formula | C16H12Cl2N2O3S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 4-[[2-[(3,4-dichlorophenyl)methylamino]-2-sulfanylideneacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)C(=S)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O3S/c17-12-6-1-9(7-13(12)18)8-19-15(24)14(21)20-11-4-2-10(3-5-11)16(22)23/h1-7H,8H2,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | ORQSHJPEBGPHTQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|