C20H17N3O4S — CID 134112452
N-(1,3-benzothiazol-2-yl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2H-pyrrole-4-carboxamide (PubChem CID 134112452) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2H-pyrrole-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2H-pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 134112452 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2H-pyrrole-4-carboxamide |
| SMILES | COc1ccc(CN2CC(O)=C(C(=O)Nc3nc4ccccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-27-13-8-6-12(7-9-13)10-23-11-15(24)17(19(23)26)18(25)22-20-21-14-4-2-3-5-16(14)28-20/h2-9,24H,10-11H2,1H3,(H,21,22,25) |
| InChIKey | CFNMQXUTJLGGTD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|