C11H9Cl3N2O3 — CID 134112648
ethyl 2-oxo-2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]acetate (PubChem CID 134112648) has the molecular formula C11H9Cl3N2O3 and a molecular weight of 323.56 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]acetate.
| Compound Name | ethyl 2-oxo-2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]acetate |
|---|---|
| PubChem CID | 134112648 |
| Molecular Formula | C11H9Cl3N2O3 |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | ethyl 2-oxo-2-[(2E)-2-[(2,3,6-trichlorophenyl)methylidene]hydrazinyl]acetate |
| SMILES | CCOC(=O)C(=O)N/N=C/c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H9Cl3N2O3/c1-2-19-11(18)10(17)16-15-5-6-7(12)3-4-8(13)9(6)14/h3-5H,2H2,1H3,(H,16,17)/b15-5+ |
| InChIKey | IYUWYYVSFJKBMC-PJQLUOCWSA-N |
| XLogP | 2.66 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|