C12H14Cl2N4OS — CID 134114011
4-N-butyl-3-N-(3,4-dichlorophenyl)-1-oxo-1,2,5-thiadiazole-3,4-diamine (PubChem CID 134114011) has the molecular formula C12H14Cl2N4OS and a molecular weight of 333.24 g/mol. Its IUPAC name is 4-N-butyl-3-N-(3,4-dichlorophenyl)-1-oxo-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 4-N-butyl-3-N-(3,4-dichlorophenyl)-1-oxo-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 134114011 |
| Molecular Formula | C12H14Cl2N4OS |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4-N-butyl-3-N-(3,4-dichlorophenyl)-1-oxo-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CCCCNC1=NS(=O)N=C1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N4OS/c1-2-3-6-15-11-12(18-20(19)17-11)16-8-4-5-9(13)10(14)7-8/h4-5,7H,2-3,6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | HUZPOXZKHXFDGU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|