C12H10N2Na2O6S2 — CID 134117524
disodium;N-[4-[4-(sulfonatoamino)phenyl]phenyl]sulfamate (PubChem CID 134117524) has the molecular formula C12H10N2Na2O6S2 and a molecular weight of 388.33 g/mol. Its IUPAC name is disodium;N-[4-[4-(sulfonatoamino)phenyl]phenyl]sulfamate.
| Compound Name | disodium;N-[4-[4-(sulfonatoamino)phenyl]phenyl]sulfamate |
|---|---|
| PubChem CID | 134117524 |
| Molecular Formula | C12H10N2Na2O6S2 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | disodium;N-[4-[4-(sulfonatoamino)phenyl]phenyl]sulfamate |
| SMILES | O=S(=O)([O-])Nc1ccc(-c2ccc(NS(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C12H12N2O6S2.2Na/c15-21(16,17)13-11-5-1-9(2-6-11)10-3-7-12(8-4-10)14-22(18,19)20;;/h1-8,13-14H,(H,15,16,17)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | QXBFYSOBIKSUCI-UHFFFAOYSA-L |
| XLogP | -4.89 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|