C9H13N2NaO3S — CID 20580404
sodium N-[4-[ethyl(methyl)amino]phenyl]sulfamate (PubChem CID 20580404) has the molecular formula C9H13N2NaO3S and a molecular weight of 252.27 g/mol. Its IUPAC name is sodium N-[4-[ethyl(methyl)amino]phenyl]sulfamate.
| Compound Name | sodium N-[4-[ethyl(methyl)amino]phenyl]sulfamate |
|---|---|
| PubChem CID | 20580404 |
| Molecular Formula | C9H13N2NaO3S |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | sodium N-[4-[ethyl(methyl)amino]phenyl]sulfamate |
| SMILES | CCN(C)c1ccc(NS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C9H14N2O3S.Na/c1-3-11(2)9-6-4-8(5-7-9)10-15(12,13)14;/h4-7,10H,3H2,1-2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | NJJDKOGMVZFSME-UHFFFAOYSA-M |
| XLogP | -1.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|