C13H10Cl2N4O2S — CID 134118420
1-(3,4-dichlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione (PubChem CID 134118420) has the molecular formula C13H10Cl2N4O2S and a molecular weight of 357.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 134118420 |
| Molecular Formula | C13H10Cl2N4O2S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione |
| SMILES | CSc1nc2[nH]c(=O)n(-c3ccc(Cl)c(Cl)c3)c(=O)c2n1C |
| InChI | InChI=1S/C13H10Cl2N4O2S/c1-18-9-10(17-13(18)22-2)16-12(21)19(11(9)20)6-3-4-7(14)8(15)5-6/h3-5H,1-2H3,(H,16,21) |
| InChIKey | AFOZNSYOTIHZNV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |