C13H11ClN4O2S — CID 134118421
1-(3-chlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione (PubChem CID 134118421) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione.
| Compound Name | 1-(3-chlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 134118421 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-(3-chlorophenyl)-7-methyl-8-methylsulfanyl-3H-purine-2,6-dione |
| SMILES | CSc1nc2[nH]c(=O)n(-c3cccc(Cl)c3)c(=O)c2n1C |
| InChI | InChI=1S/C13H11ClN4O2S/c1-17-9-10(16-13(17)21-2)15-12(20)18(11(9)19)8-5-3-4-7(14)6-8/h3-6H,1-2H3,(H,15,20) |
| InChIKey | WBUYUKPJFFNXND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |