C13H14ClN5O3 — CID 134119610
3-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)oxy]phenyl]-1-methoxy-1-methylurea (PubChem CID 134119610) has the molecular formula C13H14ClN5O3 and a molecular weight of 323.74 g/mol. Its IUPAC name is 3-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)oxy]phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)oxy]phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 134119610 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)oxy]phenyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1ccc(Oc2nc(C)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C13H14ClN5O3/c1-8-15-11(14)18-12(16-8)22-10-6-4-9(5-7-10)17-13(20)19(2)21-3/h4-7H,1-3H3,(H,17,20) |
| InChIKey | LJPRAPXYHXPVOK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|