C9H12N4O3 — CID 134123038
[6-(methylcarbamoylamino)-2-pyridinyl] N-methylcarbamate (PubChem CID 134123038) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is [6-(methylcarbamoylamino)-2-pyridinyl] N-methylcarbamate.
| Compound Name | [6-(methylcarbamoylamino)-2-pyridinyl] N-methylcarbamate |
|---|---|
| PubChem CID | 134123038 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [6-(methylcarbamoylamino)-2-pyridinyl] N-methylcarbamate |
| SMILES | CNC(=O)Nc1cccc(OC(=O)NC)n1 |
| InChI | InChI=1S/C9H12N4O3/c1-10-8(14)13-6-4-3-5-7(12-6)16-9(15)11-2/h3-5H,1-2H3,(H,11,15)(H2,10,12,13,14) |
| InChIKey | QEFKOTPQFDNAPX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |