C20H23N3O2 — CID 134123584
N'-(1,3-benzoxazol-2-yl)-N-tert-butyl-3,5-dimethylbenzohydrazide (PubChem CID 134123584) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-N-tert-butyl-3,5-dimethylbenzohydrazide.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-N-tert-butyl-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 134123584 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-N-tert-butyl-3,5-dimethylbenzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(Nc2nc3ccccc3o2)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-13-10-14(2)12-15(11-13)18(24)23(20(3,4)5)22-19-21-16-8-6-7-9-17(16)25-19/h6-12H,1-5H3,(H,21,22) |
| InChIKey | CMSSLCZNWVOVKW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|