C14H10FN5O2 — CID 134124345
1-(2-fluorophenyl)-3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)urea (PubChem CID 134124345) has the molecular formula C14H10FN5O2 and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)urea.
| Compound Name | 1-(2-fluorophenyl)-3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)urea |
|---|---|
| PubChem CID | 134124345 |
| Molecular Formula | C14H10FN5O2 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)urea |
| SMILES | O=C(Nc1nc2ccccc2[n+]([O-])n1)Nc1ccccc1F |
| InChI | InChI=1S/C14H10FN5O2/c15-9-5-1-2-6-10(9)17-14(21)18-13-16-11-7-3-4-8-12(11)20(22)19-13/h1-8H,(H2,16,17,18,19,21) |
| InChIKey | YIVWGIYPQRPNTK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|