C16H17N3OS — CID 134125900
N-[(E)-benzylideneamino]-4-pyridin-2-ylsulfanylbutanamide (PubChem CID 134125900) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-pyridin-2-ylsulfanylbutanamide.
| Compound Name | N-[(E)-benzylideneamino]-4-pyridin-2-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 134125900 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-pyridin-2-ylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccn1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C16H17N3OS/c20-15(19-18-13-14-7-2-1-3-8-14)9-6-12-21-16-10-4-5-11-17-16/h1-5,7-8,10-11,13H,6,9,12H2,(H,19,20)/b18-13+ |
| InChIKey | QTTNRQDCUDTRGC-QGOAFFKASA-N |
| XLogP | 3.10 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|