C17H21NO5 — CID 134132119
(4aR,8R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol (PubChem CID 134132119) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (4aR,8R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol.
| Compound Name | (4aR,8R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
|---|---|
| PubChem CID | 134132119 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4aR,8R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
| SMILES | CC1=CC[C@@H]2[C@@H](OC(c3ccc([N+](=O)[O-])cc3)CC2(C)O)[C@@H]1O |
| InChI | InChI=1S/C17H21NO5/c1-10-3-8-13-16(15(10)19)23-14(9-17(13,2)20)11-4-6-12(7-5-11)18(21)22/h3-7,13-16,19-20H,8-9H2,1-2H3/t13-,14?,15-,16-,17?/m1/s1 |
| InChIKey | VGMDTBYHXQIHGU-OWUKFGMTSA-N |
| XLogP | 2.50 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|