C21H19N3O6S — CID 134132311
5-[4-(2-cyclopropyl-1,3-oxazol-5-yl)phenyl]sulfonyl-8-nitro-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 134132311) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is 5-[4-(2-cyclopropyl-1,3-oxazol-5-yl)phenyl]sulfonyl-8-nitro-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 5-[4-(2-cyclopropyl-1,3-oxazol-5-yl)phenyl]sulfonyl-8-nitro-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 134132311 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 5-[4-(2-cyclopropyl-1,3-oxazol-5-yl)phenyl]sulfonyl-8-nitro-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCCN2S(=O)(=O)c1ccc(-c2cnc(C3CC3)o2)cc1 |
| InChI | InChI=1S/C21H19N3O6S/c25-24(26)16-6-9-18-19(12-16)29-11-1-10-23(18)31(27,28)17-7-4-14(5-8-17)20-13-22-21(30-20)15-2-3-15/h4-9,12-13,15H,1-3,10-11H2 |
| InChIKey | KLUPAXBSJMMAKQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 115.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|