C24H22N4O6 — CID 161260836
cyclopropanecarbonitrile;2-cyclopropyl-5-(3-nitrophenyl)-1,3-oxazole;1-(3-nitrophenyl)ethanone (PubChem CID 161260836) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is cyclopropanecarbonitrile;2-cyclopropyl-5-(3-nitrophenyl)-1,3-oxazole;1-(3-nitrophenyl)ethanone.
| Compound Name | cyclopropanecarbonitrile;2-cyclopropyl-5-(3-nitrophenyl)-1,3-oxazole;1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 161260836 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | cyclopropanecarbonitrile;2-cyclopropyl-5-(3-nitrophenyl)-1,3-oxazole;1-(3-nitrophenyl)ethanone |
| SMILES | CC(=O)c1cccc([N+](=O)[O-])c1.N#CC1CC1.O=[N+]([O-])c1cccc(-c2cnc(C3CC3)o2)c1 |
| InChI | InChI=1S/C12H10N2O3.C8H7NO3.C4H5N/c15-14(16)10-3-1-2-9(6-10)11-7-13-12(17-11)8-4-5-8;1-6(10)7-3-2-4-8(5-7)9(11)12;5-3-4-1-2-4/h1-3,6-8H,4-5H2;2-5H,1H3;4H,1-2H2 |
| InChIKey | VCNICYOXABBLLI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 153.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|