C16H20N4O3 — CID 178118881
4-methyl-3-(3-methylcyclobutyl)-1,2,4-triazole;1-(3-nitrophenyl)ethanone (PubChem CID 178118881) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-methyl-3-(3-methylcyclobutyl)-1,2,4-triazole;1-(3-nitrophenyl)ethanone.
| Compound Name | 4-methyl-3-(3-methylcyclobutyl)-1,2,4-triazole;1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 178118881 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-methyl-3-(3-methylcyclobutyl)-1,2,4-triazole;1-(3-nitrophenyl)ethanone |
| SMILES | CC(=O)c1cccc([N+](=O)[O-])c1.CC1CC(c2nncn2C)C1 |
| InChI | InChI=1S/C8H13N3.C8H7NO3/c1-6-3-7(4-6)8-10-9-5-11(8)2;1-6(10)7-3-2-4-8(5-7)9(11)12/h5-7H,3-4H2,1-2H3;2-5H,1H3 |
| InChIKey | GEVQIFAZALFEAZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|