C25H35N3O4 — CID 134141460
(1-pentyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 134141460) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (1-pentyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | (1-pentyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 134141460 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (1-pentyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | CCCCCn1cc(COC(=O)[C@H](C)[C@@H]2CCc3c(C)cc(OC(C)=O)c(C)c3C2)nn1 |
| InChI | InChI=1S/C25H35N3O4/c1-6-7-8-11-28-14-21(26-27-28)15-31-25(30)17(3)20-9-10-22-16(2)12-24(32-19(5)29)18(4)23(22)13-20/h12,14,17,20H,6-11,13,15H2,1-5H3/t17-,20-/m1/s1 |
| InChIKey | YUWXSUCHXPZAAP-YLJYHZDGSA-N |
| XLogP | 4.49 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|