C24H24IN3O3 — CID 71574620
(3S,3aS,9bR)-8-[[3-(3-iodophenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574620) has the molecular formula C24H24IN3O3 and a molecular weight of 529.38 g/mol. Its IUPAC name is (3S,3aS,9bR)-8-[[3-(3-iodophenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-8-[[3-(3-iodophenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574620 |
| Molecular Formula | C24H24IN3O3 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (3S,3aS,9bR)-8-[[3-(3-iodophenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | Cc1cc(OCc2cnnn2-c2cccc(I)c2)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C24H24IN3O3/c1-13-9-21(15(3)22-19(13)7-8-20-14(2)24(29)31-23(20)22)30-12-18-11-26-27-28(18)17-6-4-5-16(25)10-17/h4-6,9-11,14,20,23H,7-8,12H2,1-3H3/t14-,20-,23+/m0/s1 |
| InChIKey | BTLFNWBEVZVRHB-MHALITNNSA-N |
| XLogP | 4.86 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|