C28H27N3O3 — CID 71574424
(3S,3aS,9bR)-3,6,9-trimethyl-8-[(3-naphthalen-2-yltriazol-4-yl)methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574424) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is (3S,3aS,9bR)-3,6,9-trimethyl-8-[(3-naphthalen-2-yltriazol-4-yl)methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[(3-naphthalen-2-yltriazol-4-yl)methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574424 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[(3-naphthalen-2-yltriazol-4-yl)methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | Cc1cc(OCc2cnnn2-c2ccc3ccccc3c2)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C28H27N3O3/c1-16-12-25(18(3)26-23(16)10-11-24-17(2)28(32)34-27(24)26)33-15-22-14-29-30-31(22)21-9-8-19-6-4-5-7-20(19)13-21/h4-9,12-14,17,24,27H,10-11,15H2,1-3H3/t17-,24-,27+/m0/s1 |
| InChIKey | QRMKGQJGLZMYNK-BDFQYQKBSA-N |
| XLogP | 5.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |