C27H19N3O5 — CID 66572717
1-[[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]triazol-1-yl]methyl]benzo[f]chromen-3-one (PubChem CID 66572717) has the molecular formula C27H19N3O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is 1-[[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]triazol-1-yl]methyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]triazol-1-yl]methyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 66572717 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-[[4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]triazol-1-yl]methyl]benzo[f]chromen-3-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3cn(Cc4cc(=O)oc5ccc6ccccc6c45)nn3)ccc12 |
| InChI | InChI=1S/C27H19N3O5/c1-16-10-25(31)35-24-12-20(7-8-21(16)24)33-15-19-14-30(29-28-19)13-18-11-26(32)34-23-9-6-17-4-2-3-5-22(17)27(18)23/h2-12,14H,13,15H2,1H3 |
| InChIKey | VAYGJZPWFPSXIH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|