C23H17N5O7S — CID 134145685
5-[(4-nitrobenzoyl)amino]-3-phenyl-N-(4-sulfamoylphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 134145685) has the molecular formula C23H17N5O7S and a molecular weight of 507.48 g/mol. Its IUPAC name is 5-[(4-nitrobenzoyl)amino]-3-phenyl-N-(4-sulfamoylphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-[(4-nitrobenzoyl)amino]-3-phenyl-N-(4-sulfamoylphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 134145685 |
| Molecular Formula | C23H17N5O7S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 5-[(4-nitrobenzoyl)amino]-3-phenyl-N-(4-sulfamoylphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2c(-c3ccccc3)noc2NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H17N5O7S/c24-36(33,34)18-12-8-16(9-13-18)25-22(30)19-20(14-4-2-1-3-5-14)27-35-23(19)26-21(29)15-6-10-17(11-7-15)28(31)32/h1-13H,(H,25,30)(H,26,29)(H2,24,33,34) |
| InChIKey | OSURFULXBOMDNB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|