C15H18N4O5 — CID 134146073
[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]triazol-4-yl]-(4-nitrophenyl)methanol (PubChem CID 134146073) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is [1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]triazol-4-yl]-(4-nitrophenyl)methanol.
| Compound Name | [1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]triazol-4-yl]-(4-nitrophenyl)methanol |
|---|---|
| PubChem CID | 134146073 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]triazol-4-yl]-(4-nitrophenyl)methanol |
| SMILES | CC1(C)OC[C@H](Cn2cc(C(O)c3ccc([N+](=O)[O-])cc3)nn2)O1 |
| InChI | InChI=1S/C15H18N4O5/c1-15(2)23-9-12(24-15)7-18-8-13(16-17-18)14(20)10-3-5-11(6-4-10)19(21)22/h3-6,8,12,14,20H,7,9H2,1-2H3/t12-,14?/m0/s1 |
| InChIKey | PFBJIUWLUFZGSW-NBFOIZRFSA-N |
| XLogP | 1.42 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|