C22H28N8O8 — CID 134148983
(2R,3R,4S)-3-acetamido-4-[[amino-[[2-[4-(4-aminophenyl)triazol-1-yl]acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 134148983) has the molecular formula C22H28N8O8 and a molecular weight of 532.51 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-[[2-[4-(4-aminophenyl)triazol-1-yl]acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-[4-(4-aminophenyl)triazol-1-yl]acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 134148983 |
| Molecular Formula | C22H28N8O8 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-[4-(4-aminophenyl)triazol-1-yl]acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1/N=C(\N)NC(=O)Cn1cc(-c2ccc(N)cc2)nn1 |
| InChI | InChI=1S/C22H28N8O8/c1-10(32)25-18-13(6-16(21(36)37)38-20(18)19(35)15(33)9-31)26-22(24)27-17(34)8-30-7-14(28-29-30)11-2-4-12(23)5-3-11/h2-7,13,15,18-20,31,33,35H,8-9,23H2,1H3,(H,25,32)(H,36,37)(H3,24,26,27,34)/t13-,15+,18+,19+,20+/m0/s1 |
| InChIKey | DTSPCLIRLIQMJN-CWYSQHEVSA-N |
| XLogP | -3.09 |
| TPSA | 260.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|