C21H28N4O9 — CID 71723922
(2R,3R,4S)-3-acetamido-4-[[amino-[[2-(2-methoxyphenyl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71723922) has the molecular formula C21H28N4O9 and a molecular weight of 480.47 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(2-methoxyphenyl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(2-methoxyphenyl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71723922 |
| Molecular Formula | C21H28N4O9 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(2-methoxyphenyl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | COc1ccccc1CC(=O)N/C(N)=N/[C@H]1C=C(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C21H28N4O9/c1-10(27)23-17-12(8-15(20(31)32)34-19(17)18(30)13(28)9-26)24-21(22)25-16(29)7-11-5-3-4-6-14(11)33-2/h3-6,8,12-13,17-19,26,28,30H,7,9H2,1-2H3,(H,23,27)(H,31,32)(H3,22,24,25,29)/t12-,13+,17+,18+,19+/m0/s1 |
| InChIKey | YJXZYDUYEYUXMF-KIVPVIKRSA-N |
| XLogP | -2.38 |
| TPSA | 213.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|