C28H42N4O14 — CID 78113368
3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 78113368) has the molecular formula C28H42N4O14 and a molecular weight of 658.66 g/mol. Its IUPAC name is 3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 78113368 |
| Molecular Formula | C28H42N4O14 |
| Molecular Weight | 658.66 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)NC1C(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C=C(C(=O)O)OC1C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C28H42N4O14/c1-13(33)29-20-17(30-24(31-25(39)45-27(5,6)7)32-26(40)46-28(8,9)10)11-18(23(37)38)44-22(20)21(43-16(4)36)19(42-15(3)35)12-41-14(2)34/h11,17,19-22H,12H2,1-10H3,(H,29,33)(H,37,38)(H2,30,31,32,39,40) |
| InChIKey | VUKXJTXBHCASGJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 243.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|