C20H30N4O10 — CID 57271401
(2R,3R,4S)-3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid (PubChem CID 57271401) has the molecular formula C20H30N4O10 and a molecular weight of 486.48 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 57271401 |
| Molecular Formula | C20H30N4O10 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C=C(C(=O)O)O[C@H]1C(=O)O |
| InChI | InChI=1S/C20H30N4O10/c1-9(25)21-12-10(8-11(14(26)27)32-13(12)15(28)29)22-16(23-17(30)33-19(2,3)4)24-18(31)34-20(5,6)7/h8,10,12-13H,1-7H3,(H,21,25)(H,26,27)(H,28,29)(H2,22,23,24,30,31)/t10-,12+,13+/m0/s1 |
| InChIKey | KIKZWBDHXMNQPB-CYZMBNFOSA-N |
| XLogP | 0.72 |
| TPSA | 201.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|