C15H26N2O8 — CID 102062315
(2R,3R,4S)-3-(6-aminohexanoylamino)-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 102062315) has the molecular formula C15H26N2O8 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2R,3R,4S)-3-(6-aminohexanoylamino)-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-(6-aminohexanoylamino)-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 102062315 |
| Molecular Formula | C15H26N2O8 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2R,3R,4S)-3-(6-aminohexanoylamino)-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | NCCCCCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1O |
| InChI | InChI=1S/C15H26N2O8/c16-5-3-1-2-4-11(21)17-12-8(19)6-10(15(23)24)25-14(12)13(22)9(20)7-18/h6,8-9,12-14,18-20,22H,1-5,7,16H2,(H,17,21)(H,23,24)/t8-,9+,12+,13+,14+/m0/s1 |
| InChIKey | WFFHECCMGWRWMK-ZZEHVWSGSA-N |
| XLogP | -2.57 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|