C15H25NO8 — CID 142476511
(3R)-3-(hexanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 142476511) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is (3R)-3-(hexanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R)-3-(hexanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 142476511 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3R)-3-(hexanoylamino)-4-hydroxy-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCCC(=O)N[C@@H]1C(O)C=C(C(=O)O)OC1C(O)C(O)CO |
| InChI | InChI=1S/C15H25NO8/c1-2-3-4-5-11(20)16-12-8(18)6-10(15(22)23)24-14(12)13(21)9(19)7-17/h6,8-9,12-14,17-19,21H,2-5,7H2,1H3,(H,16,20)(H,22,23)/t8?,9?,12-,13?,14?/m1/s1 |
| InChIKey | YSKBVHYEQHNEAB-QMRUGVAXSA-N |
| XLogP | -1.51 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|